C32H38N2O2 — CID 58115435
6-[(1R,2R,3S,9S,12S)-16-hydroxy-7,9-dimethyl-6,7-diazapentacyclo[10.8.0.02,9.04,8.013,18]icosa-4(8),5,13(18),14,16-pentaen-3-yl]-1-phenylhexan-3-one (PubChem CID 58115435) has the molecular formula C32H38N2O2 and a molecular weight of 482.67 g/mol. Its IUPAC name is 6-[(1R,2R,3S,9S,12S)-16-hydroxy-7,9-dimethyl-6,7-diazapentacyclo[10.8.0.02,9.04,8.013,18]icosa-4(8),5,13(18),14,16-pentaen-3-yl]-1-phenylhexan-3-one.
| Compound Name | 6-[(1R,2R,3S,9S,12S)-16-hydroxy-7,9-dimethyl-6,7-diazapentacyclo[10.8.0.02,9.04,8.013,18]icosa-4(8),5,13(18),14,16-pentaen-3-yl]-1-phenylhexan-3-one |
|---|---|
| PubChem CID | 58115435 |
| Molecular Formula | C32H38N2O2 |
| Molecular Weight | 482.67 g/mol |
| Exact Mass | 482.29 |
| IUPAC Name | 6-[(1R,2R,3S,9S,12S)-16-hydroxy-7,9-dimethyl-6,7-diazapentacyclo[10.8.0.02,9.04,8.013,18]icosa-4(8),5,13(18),14,16-pentaen-3-yl]-1-phenylhexan-3-one |
| SMILES | Cn1ncc2c1[C@@]1(C)CC[C@@H]3c4ccc(O)cc4CC[C@H]3[C@@H]1[C@@H]2CCCC(=O)CCc1ccccc1 |
| InChI | InChI=1S/C32H38N2O2/c1-32-18-17-26-25-16-14-24(36)19-22(25)12-15-28(26)30(32)27(29-20-33-34(2)31(29)32)10-6-9-23(35)13-11-21-7-4-3-5-8-21/h3-5,7-8,14,16,19-20,26-28,30,36H,6,9-13,15,17-18H2,1-2H3/t26-,27-,28-,30+,32+/m1/s1 |
| InChIKey | ZEWFBSSOYLSYIJ-DFAXNXLVSA-N |
| XLogP | 6.61 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.67 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |