C23H27BrF2O2 — CID 87181879
4-[(13S)-17-(difluoromethylidene)-3-hydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]butanoyl bromide (PubChem CID 87181879) has the molecular formula C23H27BrF2O2 and a molecular weight of 453.37 g/mol. Its IUPAC name is 4-[(13S)-17-(difluoromethylidene)-3-hydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]butanoyl bromide.
| Compound Name | 4-[(13S)-17-(difluoromethylidene)-3-hydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]butanoyl bromide |
|---|---|
| PubChem CID | 87181879 |
| Molecular Formula | C23H27BrF2O2 |
| Molecular Weight | 453.37 g/mol |
| Exact Mass | 452.12 |
| IUPAC Name | 4-[(13S)-17-(difluoromethylidene)-3-hydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]butanoyl bromide |
| SMILES | C[C@]12CCC3c4ccc(O)cc4CCC3C1C(CCCC(=O)Br)CC2=C(F)F |
| InChI | InChI=1S/C23H27BrF2O2/c1-23-10-9-17-16-8-6-15(27)11-13(16)5-7-18(17)21(23)14(3-2-4-20(24)28)12-19(23)22(25)26/h6,8,11,14,17-18,21,27H,2-5,7,9-10,12H2,1H3/t14?,17?,18?,21?,23-/m1/s1 |
| InChIKey | HCQRZDNAOOFPAB-ALVKLFPMSA-N |
| XLogP | 6.72 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.37 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|