C33H42O4 — CID 58115426
(8R,9S,13S,14S,15R)-3-hydroxy-2-(2-methoxyethyl)-13-methyl-15-(4-oxo-6-phenylhexyl)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one (PubChem CID 58115426) has the molecular formula C33H42O4 and a molecular weight of 502.70 g/mol. Its IUPAC name is (8R,9S,13S,14S,15R)-3-hydroxy-2-(2-methoxyethyl)-13-methyl-15-(4-oxo-6-phenylhexyl)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one.
| Compound Name | (8R,9S,13S,14S,15R)-3-hydroxy-2-(2-methoxyethyl)-13-methyl-15-(4-oxo-6-phenylhexyl)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 58115426 |
| Molecular Formula | C33H42O4 |
| Molecular Weight | 502.70 g/mol |
| Exact Mass | 502.31 |
| IUPAC Name | (8R,9S,13S,14S,15R)-3-hydroxy-2-(2-methoxyethyl)-13-methyl-15-(4-oxo-6-phenylhexyl)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
| SMILES | COCCc1cc2c(cc1O)CC[C@H]1[C@@H]3[C@H](CCCC(=O)CCc4ccccc4)CC(=O)[C@@]3(C)CC[C@H]21 |
| InChI | InChI=1S/C33H42O4/c1-33-17-15-27-28(14-12-23-20-30(35)24(16-18-37-2)19-29(23)27)32(33)25(21-31(33)36)9-6-10-26(34)13-11-22-7-4-3-5-8-22/h3-5,7-8,19-20,25,27-28,32,35H,6,9-18,21H2,1-2H3/t25-,27+,28-,32+,33-/m1/s1 |
| InChIKey | SNACCDJBHQULOO-DXUDAVKDSA-N |
| XLogP | 6.60 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.70 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |