C26H31IN2O3S — CID 90468388
3-[(13S,15R)-2-iodo-3-methoxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]-N-(5-methyl-1,3-thiazol-2-yl)propanamide (PubChem CID 90468388) has the molecular formula C26H31IN2O3S and a molecular weight of 578.52 g/mol. Its IUPAC name is 3-[(13S,15R)-2-iodo-3-methoxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]-N-(5-methyl-1,3-thiazol-2-yl)propanamide.
| Compound Name | 3-[(13S,15R)-2-iodo-3-methoxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]-N-(5-methyl-1,3-thiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 90468388 |
| Molecular Formula | C26H31IN2O3S |
| Molecular Weight | 578.52 g/mol |
| Exact Mass | 578.11 |
| IUPAC Name | 3-[(13S,15R)-2-iodo-3-methoxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]-N-(5-methyl-1,3-thiazol-2-yl)propanamide |
| SMILES | COc1cc2c(cc1I)C1CC[C@]3(C)C(=O)CC(CCC(=O)Nc4ncc(C)s4)C3C1CC2 |
| InChI | InChI=1S/C26H31IN2O3S/c1-14-13-28-25(33-14)29-23(31)7-5-16-11-22(30)26(2)9-8-17-18(24(16)26)6-4-15-10-21(32-3)20(27)12-19(15)17/h10,12-13,16-18,24H,4-9,11H2,1-3H3,(H,28,29,31)/t16?,17?,18?,24?,26-/m1/s1 |
| InChIKey | RQAQCLCATZPZJA-BZPPFLNXSA-N |
| XLogP | 6.13 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.52 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|