C26H32N2O3S — CID 91352331
3-[(13S)-3-methoxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-2-yl]-N-(5-methyl-1,3-thiazol-2-yl)propanamide (PubChem CID 91352331) has the molecular formula C26H32N2O3S and a molecular weight of 452.62 g/mol. Its IUPAC name is 3-[(13S)-3-methoxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-2-yl]-N-(5-methyl-1,3-thiazol-2-yl)propanamide.
| Compound Name | 3-[(13S)-3-methoxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-2-yl]-N-(5-methyl-1,3-thiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 91352331 |
| Molecular Formula | C26H32N2O3S |
| Molecular Weight | 452.62 g/mol |
| Exact Mass | 452.21 |
| IUPAC Name | 3-[(13S)-3-methoxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-2-yl]-N-(5-methyl-1,3-thiazol-2-yl)propanamide |
| SMILES | COc1cc2c(cc1CCC(=O)Nc1ncc(C)s1)C1CC[C@]3(C)C(=O)CCC3C1CC2 |
| InChI | InChI=1S/C26H32N2O3S/c1-15-14-27-25(32-15)28-24(30)9-5-17-12-20-16(13-22(17)31-3)4-6-19-18(20)10-11-26(2)21(19)7-8-23(26)29/h12-14,18-19,21H,4-11H2,1-3H3,(H,27,28,30)/t18?,19?,21?,26-/m0/s1 |
| InChIKey | JFEZVKAFPFFIPW-VSCBGOJPSA-N |
| XLogP | 5.46 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.62 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |