C25H31BF2N2O3S — CID 91413792
[(8R,9S,13S,14S)-17,17-difluoro-13-methyl-2-[3-[(5-methyl-1,3-thiazol-2-yl)amino]-3-oxopropyl]-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl]boronic acid (PubChem CID 91413792) has the molecular formula C25H31BF2N2O3S and a molecular weight of 488.41 g/mol. Its IUPAC name is [(8R,9S,13S,14S)-17,17-difluoro-13-methyl-2-[3-[(5-methyl-1,3-thiazol-2-yl)amino]-3-oxopropyl]-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl]boronic acid.
| Compound Name | [(8R,9S,13S,14S)-17,17-difluoro-13-methyl-2-[3-[(5-methyl-1,3-thiazol-2-yl)amino]-3-oxopropyl]-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl]boronic acid |
|---|---|
| PubChem CID | 91413792 |
| Molecular Formula | C25H31BF2N2O3S |
| Molecular Weight | 488.41 g/mol |
| Exact Mass | 488.21 |
| IUPAC Name | [(8R,9S,13S,14S)-17,17-difluoro-13-methyl-2-[3-[(5-methyl-1,3-thiazol-2-yl)amino]-3-oxopropyl]-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl]boronic acid |
| SMILES | Cc1cnc(NC(=O)CCc2cc3c(cc2B(O)O)CC[C@@H]2[C@@H]3CC[C@@]3(C)[C@H]2CCC3(F)F)s1 |
| InChI | InChI=1S/C25H31BF2N2O3S/c1-14-13-29-23(34-14)30-22(31)6-4-16-11-19-15(12-21(16)26(32)33)3-5-18-17(19)7-9-24(2)20(18)8-10-25(24,27)28/h11-13,17-18,20,32-33H,3-10H2,1-2H3,(H,29,30,31)/t17-,18+,20-,24-/m0/s1 |
| InChIKey | VTRBYPYVKDXMQT-KBVWPGPTSA-N |
| XLogP | 4.19 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.41 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|