C25H30FN3O3S — CID 123611941
3-(2-amino-4-fluoro-3-hydroxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl)-N-(5-methyl-1,3-thiazol-2-yl)propanamide (PubChem CID 123611941) has the molecular formula C25H30FN3O3S and a molecular weight of 471.60 g/mol. Its IUPAC name is 3-(2-amino-4-fluoro-3-hydroxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl)-N-(5-methyl-1,3-thiazol-2-yl)propanamide.
| Compound Name | 3-(2-amino-4-fluoro-3-hydroxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl)-N-(5-methyl-1,3-thiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 123611941 |
| Molecular Formula | C25H30FN3O3S |
| Molecular Weight | 471.60 g/mol |
| Exact Mass | 471.20 |
| IUPAC Name | 3-(2-amino-4-fluoro-3-hydroxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl)-N-(5-methyl-1,3-thiazol-2-yl)propanamide |
| SMILES | Cc1cnc(NC(=O)CCC2CC(=O)C3(C)CCC4c5cc(N)c(O)c(F)c5CCC4C23)s1 |
| InChI | InChI=1S/C25H30FN3O3S/c1-12-11-28-24(33-12)29-20(31)6-3-13-9-19(30)25(2)8-7-14-15(21(13)25)4-5-16-17(14)10-18(27)23(32)22(16)26/h10-11,13-15,21,32H,3-9,27H2,1-2H3,(H,28,29,31) |
| InChIKey | SNAAPJQQBBSMFI-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 105.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.60 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|