C35H43F3O3 — CID 66858598
4-[(8R,9S,13S,14S)-13-methyl-3-phenylmethoxy-17-(trifluoromethyl)-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-15-yl]butyl 2,2-dimethylpropanoate (PubChem CID 66858598) has the molecular formula C35H43F3O3 and a molecular weight of 568.72 g/mol. Its IUPAC name is 4-[(8R,9S,13S,14S)-13-methyl-3-phenylmethoxy-17-(trifluoromethyl)-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-15-yl]butyl 2,2-dimethylpropanoate.
| Compound Name | 4-[(8R,9S,13S,14S)-13-methyl-3-phenylmethoxy-17-(trifluoromethyl)-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-15-yl]butyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 66858598 |
| Molecular Formula | C35H43F3O3 |
| Molecular Weight | 568.72 g/mol |
| Exact Mass | 568.32 |
| IUPAC Name | 4-[(8R,9S,13S,14S)-13-methyl-3-phenylmethoxy-17-(trifluoromethyl)-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-15-yl]butyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OCCCCC1C=C(C(F)(F)F)[C@@]2(C)CC[C@@H]3c4ccc(OCc5ccccc5)cc4CC[C@H]3[C@H]12 |
| InChI | InChI=1S/C35H43F3O3/c1-33(2,3)32(39)40-19-9-8-12-25-21-30(35(36,37)38)34(4)18-17-28-27-16-14-26(41-22-23-10-6-5-7-11-23)20-24(27)13-15-29(28)31(25)34/h5-7,10-11,14,16,20-21,25,28-29,31H,8-9,12-13,15,17-19,22H2,1-4H3/t25?,28-,29-,31+,34-/m1/s1 |
| InChIKey | BDMOUTIIOVNZKX-QKOOKCJISA-N |
| XLogP | 9.21 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.72 |
| LogP ≤ 5 | 9.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|