C18H24O2 — CID 154339603
(8R,9S,13S,14S)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-1,3-diol (PubChem CID 154339603) has the molecular formula C18H24O2 and a molecular weight of 272.39 g/mol. Its IUPAC name is (8R,9S,13S,14S)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-1,3-diol.
| Compound Name | (8R,9S,13S,14S)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-1,3-diol |
|---|---|
| PubChem CID | 154339603 |
| Molecular Formula | C18H24O2 |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.18 |
| IUPAC Name | (8R,9S,13S,14S)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-1,3-diol |
| SMILES | C[C@@]12CCC[C@H]1[C@H]1CCc3cc(O)cc(O)c3[C@H]1CC2 |
| InChI | InChI=1S/C18H24O2/c1-18-7-2-3-15(18)13-5-4-11-9-12(19)10-16(20)17(11)14(13)6-8-18/h9-10,13-15,19-20H,2-8H2,1H3/t13-,14-,15-,18-/m0/s1 |
| InChIKey | OJTAFIRLWPUEDW-XSWJXKHESA-N |
| XLogP | 4.34 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |