C20H24O4 — CID 22789116
(8R,9S,13S,14S,16R,17R)-17-ethynyl-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-1,3,16,17-tetrol (PubChem CID 22789116) has the molecular formula C20H24O4 and a molecular weight of 328.41 g/mol. Its IUPAC name is (8R,9S,13S,14S,16R,17R)-17-ethynyl-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-1,3,16,17-tetrol.
| Compound Name | (8R,9S,13S,14S,16R,17R)-17-ethynyl-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-1,3,16,17-tetrol |
|---|---|
| PubChem CID | 22789116 |
| Molecular Formula | C20H24O4 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | (8R,9S,13S,14S,16R,17R)-17-ethynyl-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-1,3,16,17-tetrol |
| SMILES | C#C[C@]1(O)[C@H](O)C[C@H]2[C@H]3CCc4cc(O)cc(O)c4[C@H]3CC[C@@]21C |
| InChI | InChI=1S/C20H24O4/c1-3-20(24)17(23)10-15-13-5-4-11-8-12(21)9-16(22)18(11)14(13)6-7-19(15,20)2/h1,8-9,13-15,17,21-24H,4-7,10H2,2H3/t13-,14-,15-,17+,19-,20-/m0/s1 |
| InChIKey | IDNHRBXCWNEXHC-OPDDSMGGSA-N |
| XLogP | 2.29 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|