C46H54O8 — CID 87926263
3,3-bis[(8R,9S,14S,17R)-17-ethynyl-3,17-dihydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-1-yl]hexanedioic acid (PubChem CID 87926263) has the molecular formula C46H54O8 and a molecular weight of 734.93 g/mol. Its IUPAC name is 3,3-bis[(8R,9S,14S,17R)-17-ethynyl-3,17-dihydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-1-yl]hexanedioic acid.
| Compound Name | 3,3-bis[(8R,9S,14S,17R)-17-ethynyl-3,17-dihydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-1-yl]hexanedioic acid |
|---|---|
| PubChem CID | 87926263 |
| Molecular Formula | C46H54O8 |
| Molecular Weight | 734.93 g/mol |
| Exact Mass | 734.38 |
| IUPAC Name | 3,3-bis[(8R,9S,14S,17R)-17-ethynyl-3,17-dihydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-1-yl]hexanedioic acid |
| SMILES | C#C[C@]1(O)CC[C@H]2[C@@H]3CCc4cc(O)cc(C(CCC(=O)O)(CC(=O)O)c5cc(O)cc6c5[C@H]5CCC7(C)[C@@H](CC[C@@]7(O)C#C)[C@@H]5CC6)c4[C@H]3CCC21C |
| InChI | InChI=1S/C46H54O8/c1-5-45(53)19-13-34-30-9-7-26-21-28(47)23-36(40(26)32(30)11-16-42(34,45)3)44(25-39(51)52,18-15-38(49)50)37-24-29(48)22-27-8-10-31-33(41(27)37)12-17-43(4)35(31)14-20-46(43,54)6-2/h1-2,21-24,30-35,47-48,53-54H,7-20,25H2,3-4H3,(H,49,50)(H,51,52)/t30-,31-,32+,33+,34+,35+,42?,43?,44?,45+,46+/m1/s1 |
| InChIKey | XLKACEGOJRTGGT-DDINLJGSSA-N |
| XLogP | 7.16 |
| TPSA | 155.52 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.93 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|