C45H53NO8 — CID 87941398
(2S)-2-amino-3,3-bis[(8R,9S,14S,17R)-17-ethynyl-3,17-dihydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-1-yl]pentanedioic acid (PubChem CID 87941398) has the molecular formula C45H53NO8 and a molecular weight of 735.92 g/mol. Its IUPAC name is (2S)-2-amino-3,3-bis[(8R,9S,14S,17R)-17-ethynyl-3,17-dihydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-1-yl]pentanedioic acid.
| Compound Name | (2S)-2-amino-3,3-bis[(8R,9S,14S,17R)-17-ethynyl-3,17-dihydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-1-yl]pentanedioic acid |
|---|---|
| PubChem CID | 87941398 |
| Molecular Formula | C45H53NO8 |
| Molecular Weight | 735.92 g/mol |
| Exact Mass | 735.38 |
| IUPAC Name | (2S)-2-amino-3,3-bis[(8R,9S,14S,17R)-17-ethynyl-3,17-dihydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-1-yl]pentanedioic acid |
| SMILES | C#C[C@]1(O)CC[C@H]2[C@@H]3CCc4cc(O)cc(C(CC(=O)O)(c5cc(O)cc6c5[C@H]5CCC7(C)[C@@H](CC[C@@]7(O)C#C)[C@@H]5CC6)[C@H](N)C(=O)O)c4[C@H]3CCC21C |
| InChI | InChI=1S/C45H53NO8/c1-5-43(53)17-13-32-28-9-7-24-19-26(47)21-34(37(24)30(28)11-15-41(32,43)3)45(23-36(49)50,39(46)40(51)52)35-22-27(48)20-25-8-10-29-31(38(25)35)12-16-42(4)33(29)14-18-44(42,54)6-2/h1-2,19-22,28-33,39,47-48,53-54H,7-18,23,46H2,3-4H3,(H,49,50)(H,51,52)/t28-,29-,30+,31+,32+,33+,39-,41?,42?,43+,44+,45?/m1/s1 |
| InChIKey | RCPUEIVOHLFFDL-XZOXDXDDSA-N |
| XLogP | 5.71 |
| TPSA | 181.54 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.92 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|