C21H24O3 — CID 174348056
(8R,9S,14S,17R)-17-ethynyl-3,17-dihydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-1-carbaldehyde (PubChem CID 174348056) has the molecular formula C21H24O3 and a molecular weight of 324.42 g/mol. Its IUPAC name is (8R,9S,14S,17R)-17-ethynyl-3,17-dihydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-1-carbaldehyde.
| Compound Name | (8R,9S,14S,17R)-17-ethynyl-3,17-dihydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-1-carbaldehyde |
|---|---|
| PubChem CID | 174348056 |
| Molecular Formula | C21H24O3 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | (8R,9S,14S,17R)-17-ethynyl-3,17-dihydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-1-carbaldehyde |
| SMILES | C#C[C@]1(O)CC[C@H]2[C@@H]3CCc4cc(O)cc(C=O)c4[C@H]3CCC21C |
| InChI | InChI=1S/C21H24O3/c1-3-21(24)9-7-18-16-5-4-13-10-15(23)11-14(12-22)19(13)17(16)6-8-20(18,21)2/h1,10-12,16-18,23-24H,4-9H2,2H3/t16-,17+,18+,20?,21+/m1/s1 |
| InChIKey | BRMKIQWPYOJEPM-IHZZPTOJSA-N |
| XLogP | 3.43 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|