C36H54O4 — CID 90884608
[(8R,9S,13S,14S)-3-hydroxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-2-yl] octadec-9-enoate (PubChem CID 90884608) has the molecular formula C36H54O4 and a molecular weight of 550.82 g/mol. Its IUPAC name is [(8R,9S,13S,14S)-3-hydroxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-2-yl] octadec-9-enoate.
| Compound Name | [(8R,9S,13S,14S)-3-hydroxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-2-yl] octadec-9-enoate |
|---|---|
| PubChem CID | 90884608 |
| Molecular Formula | C36H54O4 |
| Molecular Weight | 550.82 g/mol |
| Exact Mass | 550.40 |
| IUPAC Name | [(8R,9S,13S,14S)-3-hydroxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-2-yl] octadec-9-enoate |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)Oc1cc2c(cc1O)CC[C@@H]1[C@@H]2CC[C@]2(C)C(=O)CC[C@@H]12 |
| InChI | InChI=1S/C36H54O4/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-35(39)40-33-26-30-27(25-32(33)37)19-20-29-28(30)23-24-36(2)31(29)21-22-34(36)38/h10-11,25-26,28-29,31,37H,3-9,12-24H2,1-2H3/t28-,29+,31-,36-/m0/s1 |
| InChIKey | CFDHFZINKHONRH-HKFSTLGXSA-N |
| XLogP | 9.76 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.82 |
| LogP ≤ 5 | 9.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|