C26H31BrClNO — CID 10529046
(1S,3S,4aS,4bR,10bS,12aS)-N-(4-bromophenyl)-3-chloro-8-methoxy-12a-methyl-2,3,4,4a,4b,5,6,10b,11,12-decahydro-1H-chrysen-1-amine (PubChem CID 10529046) has the molecular formula C26H31BrClNO and a molecular weight of 488.90 g/mol. Its IUPAC name is (1S,3S,4aS,4bR,10bS,12aS)-N-(4-bromophenyl)-3-chloro-8-methoxy-12a-methyl-2,3,4,4a,4b,5,6,10b,11,12-decahydro-1H-chrysen-1-amine.
| Compound Name | (1S,3S,4aS,4bR,10bS,12aS)-N-(4-bromophenyl)-3-chloro-8-methoxy-12a-methyl-2,3,4,4a,4b,5,6,10b,11,12-decahydro-1H-chrysen-1-amine |
|---|---|
| PubChem CID | 10529046 |
| Molecular Formula | C26H31BrClNO |
| Molecular Weight | 488.90 g/mol |
| Exact Mass | 487.13 |
| IUPAC Name | (1S,3S,4aS,4bR,10bS,12aS)-N-(4-bromophenyl)-3-chloro-8-methoxy-12a-methyl-2,3,4,4a,4b,5,6,10b,11,12-decahydro-1H-chrysen-1-amine |
| SMILES | COc1ccc2c(c1)CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](Nc3ccc(Br)cc3)C[C@@H](Cl)C[C@@H]12 |
| InChI | InChI=1S/C26H31BrClNO/c1-26-12-11-22-21-10-8-20(30-2)13-16(21)3-9-23(22)24(26)14-18(28)15-25(26)29-19-6-4-17(27)5-7-19/h4-8,10,13,18,22-25,29H,3,9,11-12,14-15H2,1-2H3/t18-,22+,23+,24-,25-,26-/m0/s1 |
| InChIKey | CKCAKDAQYGVPMI-NIPAYODJSA-N |
| XLogP | 7.40 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.90 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|