C25H29BrN2O3 — CID 100922698
(4aS,4bS,10bS,12aS)-3-bromo-8-methoxy-N-(4-nitrophenyl)-1,2,3,4,4a,4b,5,6,10b,11,12,12a-dodecahydrochrysen-1-amine (PubChem CID 100922698) has the molecular formula C25H29BrN2O3 and a molecular weight of 485.42 g/mol. Its IUPAC name is (4aS,4bS,10bS,12aS)-3-bromo-8-methoxy-N-(4-nitrophenyl)-1,2,3,4,4a,4b,5,6,10b,11,12,12a-dodecahydrochrysen-1-amine.
| Compound Name | (4aS,4bS,10bS,12aS)-3-bromo-8-methoxy-N-(4-nitrophenyl)-1,2,3,4,4a,4b,5,6,10b,11,12,12a-dodecahydrochrysen-1-amine |
|---|---|
| PubChem CID | 100922698 |
| Molecular Formula | C25H29BrN2O3 |
| Molecular Weight | 485.42 g/mol |
| Exact Mass | 484.14 |
| IUPAC Name | (4aS,4bS,10bS,12aS)-3-bromo-8-methoxy-N-(4-nitrophenyl)-1,2,3,4,4a,4b,5,6,10b,11,12,12a-dodecahydrochrysen-1-amine |
| SMILES | COc1ccc2c(c1)CC[C@H]1[C@@H]3CC(Br)CC(Nc4ccc([N+](=O)[O-])cc4)[C@H]3CC[C@H]21 |
| InChI | InChI=1S/C25H29BrN2O3/c1-31-19-7-9-20-15(12-19)2-8-22-21(20)10-11-23-24(22)13-16(26)14-25(23)27-17-3-5-18(6-4-17)28(29)30/h3-7,9,12,16,21-25,27H,2,8,10-11,13-14H2,1H3/t16?,21-,22-,23+,24+,25?/m1/s1 |
| InChIKey | JIJBHWONHYACKH-BUUMZITOSA-N |
| XLogP | 6.31 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.42 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|