C20H26O3 — CID 24761046
(13S,17S)-13-ethyl-2-methoxy-6,7,8,9,11,12,14,17-octahydrocyclopenta[a]phenanthrene-3,17-diol (PubChem CID 24761046) has the molecular formula C20H26O3 and a molecular weight of 314.43 g/mol. Its IUPAC name is (13S,17S)-13-ethyl-2-methoxy-6,7,8,9,11,12,14,17-octahydrocyclopenta[a]phenanthrene-3,17-diol.
| Compound Name | (13S,17S)-13-ethyl-2-methoxy-6,7,8,9,11,12,14,17-octahydrocyclopenta[a]phenanthrene-3,17-diol |
|---|---|
| PubChem CID | 24761046 |
| Molecular Formula | C20H26O3 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.19 |
| IUPAC Name | (13S,17S)-13-ethyl-2-methoxy-6,7,8,9,11,12,14,17-octahydrocyclopenta[a]phenanthrene-3,17-diol |
| SMILES | CC[C@]12CCC3c4cc(OC)c(O)cc4CCC3C1C=C[C@@H]2O |
| InChI | InChI=1S/C20H26O3/c1-3-20-9-8-13-14(16(20)6-7-19(20)22)5-4-12-10-17(21)18(23-2)11-15(12)13/h6-7,10-11,13-14,16,19,21-22H,3-5,8-9H2,1-2H3/t13?,14?,16?,19-,20-/m0/s1 |
| InChIKey | ACNQKPPIHGODND-BMSRGXOESA-N |
| XLogP | 3.78 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|