C17H24O — CID 89054321
1-butoxy-2-cyclopentyl-4-ethenylbenzene (PubChem CID 89054321) has the molecular formula C17H24O and a molecular weight of 244.38 g/mol. Its IUPAC name is 1-butoxy-2-cyclopentyl-4-ethenylbenzene.
| Compound Name | 1-butoxy-2-cyclopentyl-4-ethenylbenzene |
|---|---|
| PubChem CID | 89054321 |
| Molecular Formula | C17H24O |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.18 |
| IUPAC Name | 1-butoxy-2-cyclopentyl-4-ethenylbenzene |
| SMILES | C=Cc1ccc(OCCCC)c(C2CCCC2)c1 |
| InChI | InChI=1S/C17H24O/c1-3-5-12-18-17-11-10-14(4-2)13-16(17)15-8-6-7-9-15/h4,10-11,13,15H,2-3,5-9,12H2,1H3 |
| InChIKey | DCFHTSPKQYXMRQ-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|