C21H33NO4 — CID 166924586
2-[4-(2-butoxyethoxy)-3-cyclopropylphenyl]-4,4,5,5-tetramethyl-1,3,2-dioxazolidine (PubChem CID 166924586) has the molecular formula C21H33NO4 and a molecular weight of 363.50 g/mol. Its IUPAC name is 2-[4-(2-butoxyethoxy)-3-cyclopropylphenyl]-4,4,5,5-tetramethyl-1,3,2-dioxazolidine.
| Compound Name | 2-[4-(2-butoxyethoxy)-3-cyclopropylphenyl]-4,4,5,5-tetramethyl-1,3,2-dioxazolidine |
|---|---|
| PubChem CID | 166924586 |
| Molecular Formula | C21H33NO4 |
| Molecular Weight | 363.50 g/mol |
| Exact Mass | 363.24 |
| IUPAC Name | 2-[4-(2-butoxyethoxy)-3-cyclopropylphenyl]-4,4,5,5-tetramethyl-1,3,2-dioxazolidine |
| SMILES | CCCCOCCOc1ccc(N2OC(C)(C)C(C)(C)O2)cc1C1CC1 |
| InChI | InChI=1S/C21H33NO4/c1-6-7-12-23-13-14-24-19-11-10-17(15-18(19)16-8-9-16)22-25-20(2,3)21(4,5)26-22/h10-11,15-16H,6-9,12-14H2,1-5H3 |
| InChIKey | NKNQZKAEUPQNOO-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.50 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|