C20H33NO3 — CID 166924695
2-[4-(2-butoxyethoxy)-2-methylphenyl]-4,4,5,5-tetramethyl-1,2-oxazolidine (PubChem CID 166924695) has the molecular formula C20H33NO3 and a molecular weight of 335.49 g/mol. Its IUPAC name is 2-[4-(2-butoxyethoxy)-2-methylphenyl]-4,4,5,5-tetramethyl-1,2-oxazolidine.
| Compound Name | 2-[4-(2-butoxyethoxy)-2-methylphenyl]-4,4,5,5-tetramethyl-1,2-oxazolidine |
|---|---|
| PubChem CID | 166924695 |
| Molecular Formula | C20H33NO3 |
| Molecular Weight | 335.49 g/mol |
| Exact Mass | 335.25 |
| IUPAC Name | 2-[4-(2-butoxyethoxy)-2-methylphenyl]-4,4,5,5-tetramethyl-1,2-oxazolidine |
| SMILES | CCCCOCCOc1ccc(N2CC(C)(C)C(C)(C)O2)c(C)c1 |
| InChI | InChI=1S/C20H33NO3/c1-7-8-11-22-12-13-23-17-9-10-18(16(2)14-17)21-15-19(3,4)20(5,6)24-21/h9-10,14H,7-8,11-13,15H2,1-6H3 |
| InChIKey | YDPLTEUWLMDUJG-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.49 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|