About N-ethylethanamine;(phenyldiselanyl)benzene
N-ethylethanamine;(phenyldiselanyl)benzene (PubChem CID 87750147) has the molecular formula C16H21NSe2
and a molecular weight of 385.27 g/mol. Its IUPAC name is N-ethylethanamine;(phenyldiselanyl)benzene.
Molecular Properties
| Compound Name | N-ethylethanamine;(phenyldiselanyl)benzene |
| PubChem CID | 87750147 |
| Molecular Formula | C16H21NSe2 |
| Molecular Weight | 385.27 g/mol |
| Exact Mass | 387.00 |
| IUPAC Name | N-ethylethanamine;(phenyldiselanyl)benzene |
| SMILES | CCNCC.c1ccc([Se][Se]c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10Se2.C4H11N/c1-3-7-11(8-4-1)13-14-12-9-5-2-6-10-12;1-3-5-4-2/h1-10H;5H,3-4H2,1-2H3 |
| InChIKey | NEINUZGNBWUATQ-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.27 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze N-ethylethanamine;(phenyldiselanyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethylethanamine;(phenyldiselanyl)benzene?
The IUPAC name of N-ethylethanamine;(phenyldiselanyl)benzene (CID 87750147) is N-ethylethanamine;(phenyldiselanyl)benzene.
What is the SMILES notation for N-ethylethanamine;(phenyldiselanyl)benzene?
The canonical SMILES for N-ethylethanamine;(phenyldiselanyl)benzene is CCNCC.c1ccc([Se][Se]c2ccccc2)cc1.
What is the InChIKey of N-ethylethanamine;(phenyldiselanyl)benzene?
The InChIKey is NEINUZGNBWUATQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10Se2.C4H11N/c1-3-7-11(8-4-1)13-14-12-9-5-2-6-10-12;1-3-5-4-2/h1-10H;5H,3-4H2,1-2H3.
What are the key properties of N-ethylethanamine;(phenyldiselanyl)benzene?
N-ethylethanamine;(phenyldiselanyl)benzene has a molecular weight of 385.27 g/mol, XLogP of 1.58, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethylethanamine;(phenyldiselanyl)benzene is sourced from PubChem (CID 87750147), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).