C12H10N2O2 — CID 57116290
2-(7-nitro-3,4-dihydro-2H-naphthalen-1-ylidene)acetonitrile (PubChem CID 57116290) has the molecular formula C12H10N2O2 and a molecular weight of 214.22 g/mol. Its IUPAC name is 2-(7-nitro-3,4-dihydro-2H-naphthalen-1-ylidene)acetonitrile.
| Compound Name | 2-(7-nitro-3,4-dihydro-2H-naphthalen-1-ylidene)acetonitrile |
|---|---|
| PubChem CID | 57116290 |
| Molecular Formula | C12H10N2O2 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.07 |
| IUPAC Name | 2-(7-nitro-3,4-dihydro-2H-naphthalen-1-ylidene)acetonitrile |
| SMILES | N#CC=C1CCCc2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C12H10N2O2/c13-7-6-10-3-1-2-9-4-5-11(14(15)16)8-12(9)10/h4-6,8H,1-3H2 |
| InChIKey | AFHVCNXJPAHDBP-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 66.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|