C12H8N4O4S — CID 88898497
2,8-dinitrodibenzothiophene-3,7-diamine (PubChem CID 88898497) has the molecular formula C12H8N4O4S and a molecular weight of 304.29 g/mol. Its IUPAC name is 2,8-dinitrodibenzothiophene-3,7-diamine.
| Compound Name | 2,8-dinitrodibenzothiophene-3,7-diamine |
|---|---|
| PubChem CID | 88898497 |
| Molecular Formula | C12H8N4O4S |
| Molecular Weight | 304.29 g/mol |
| Exact Mass | 304.03 |
| IUPAC Name | 2,8-dinitrodibenzothiophene-3,7-diamine |
| SMILES | Nc1cc2sc3cc(N)c([N+](=O)[O-])cc3c2cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H8N4O4S/c13-7-3-11-5(1-9(7)15(17)18)6-2-10(16(19)20)8(14)4-12(6)21-11/h1-4H,13-14H2 |
| InChIKey | XVBLVSCPOVCKPU-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 138.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.29 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|