C16H20ClNO5 — CID 172547295
2-[(5-chloro-4-methoxy-2-nitrophenoxy)methyl]-5,5-dimethylhex-1-en-3-one (PubChem CID 172547295) has the molecular formula C16H20ClNO5 and a molecular weight of 341.79 g/mol. Its IUPAC name is 2-[(5-chloro-4-methoxy-2-nitrophenoxy)methyl]-5,5-dimethylhex-1-en-3-one.
| Compound Name | 2-[(5-chloro-4-methoxy-2-nitrophenoxy)methyl]-5,5-dimethylhex-1-en-3-one |
|---|---|
| PubChem CID | 172547295 |
| Molecular Formula | C16H20ClNO5 |
| Molecular Weight | 341.79 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | 2-[(5-chloro-4-methoxy-2-nitrophenoxy)methyl]-5,5-dimethylhex-1-en-3-one |
| SMILES | C=C(COc1cc(Cl)c(OC)cc1[N+](=O)[O-])C(=O)CC(C)(C)C |
| InChI | InChI=1S/C16H20ClNO5/c1-10(13(19)8-16(2,3)4)9-23-15-6-11(17)14(22-5)7-12(15)18(20)21/h6-7H,1,8-9H2,2-5H3 |
| InChIKey | LVJCGRBXEXZELU-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.79 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|