C16H18Cl4N2O6Sn — CID 165072358
2-chloro-4,5-dimethoxyaniline;1-chloro-4,5-dimethoxy-2-nitrobenzene;dichlorotin (PubChem CID 165072358) has the molecular formula C16H18Cl4N2O6Sn and a molecular weight of 594.85 g/mol. Its IUPAC name is 2-chloro-4,5-dimethoxyaniline;1-chloro-4,5-dimethoxy-2-nitrobenzene;dichlorotin.
| Compound Name | 2-chloro-4,5-dimethoxyaniline;1-chloro-4,5-dimethoxy-2-nitrobenzene;dichlorotin |
|---|---|
| PubChem CID | 165072358 |
| Molecular Formula | C16H18Cl4N2O6Sn |
| Molecular Weight | 594.85 g/mol |
| Exact Mass | 593.89 |
| IUPAC Name | 2-chloro-4,5-dimethoxyaniline;1-chloro-4,5-dimethoxy-2-nitrobenzene;dichlorotin |
| SMILES | COc1cc(Cl)c([N+](=O)[O-])cc1OC.COc1cc(N)c(Cl)cc1OC.Cl[Sn]Cl |
| InChI | InChI=1S/C8H8ClNO4.C8H10ClNO2.2ClH.Sn/c1-13-7-3-5(9)6(10(11)12)4-8(7)14-2;1-11-7-3-5(9)6(10)4-8(7)12-2;;;/h3-4H,1-2H3;3-4H,10H2,1-2H3;2*1H;/q;;;;+2/p-2 |
| InChIKey | SZCSORLFLCZCFX-UHFFFAOYSA-L |
| XLogP | 5.20 |
| TPSA | 106.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.85 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|