C9H6ClF2N3O3 — CID 147399570
4-amino-3-chloro-2-(2,2-difluoroethoxy)-5-nitrobenzonitrile (PubChem CID 147399570) has the molecular formula C9H6ClF2N3O3 and a molecular weight of 277.61 g/mol. Its IUPAC name is 4-amino-3-chloro-2-(2,2-difluoroethoxy)-5-nitrobenzonitrile.
| Compound Name | 4-amino-3-chloro-2-(2,2-difluoroethoxy)-5-nitrobenzonitrile |
|---|---|
| PubChem CID | 147399570 |
| Molecular Formula | C9H6ClF2N3O3 |
| Molecular Weight | 277.61 g/mol |
| Exact Mass | 277.01 |
| IUPAC Name | 4-amino-3-chloro-2-(2,2-difluoroethoxy)-5-nitrobenzonitrile |
| SMILES | N#Cc1cc([N+](=O)[O-])c(N)c(Cl)c1OCC(F)F |
| InChI | InChI=1S/C9H6ClF2N3O3/c10-7-8(14)5(15(16)17)1-4(2-13)9(7)18-3-6(11)12/h1,6H,3,14H2 |
| InChIKey | DOMDJKDSRHTYGS-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 102.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.61 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|