C9H10F2N2O4S — CID 171245215
ethyl (3R)-3-amino-2,2-difluoro-3-(5-nitrothiophen-3-yl)propanoate (PubChem CID 171245215) has the molecular formula C9H10F2N2O4S and a molecular weight of 280.25 g/mol. Its IUPAC name is ethyl (3R)-3-amino-2,2-difluoro-3-(5-nitrothiophen-3-yl)propanoate.
| Compound Name | ethyl (3R)-3-amino-2,2-difluoro-3-(5-nitrothiophen-3-yl)propanoate |
|---|---|
| PubChem CID | 171245215 |
| Molecular Formula | C9H10F2N2O4S |
| Molecular Weight | 280.25 g/mol |
| Exact Mass | 280.03 |
| IUPAC Name | ethyl (3R)-3-amino-2,2-difluoro-3-(5-nitrothiophen-3-yl)propanoate |
| SMILES | CCOC(=O)C(F)(F)[C@H](N)c1csc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C9H10F2N2O4S/c1-2-17-8(14)9(10,11)7(12)5-3-6(13(15)16)18-4-5/h3-4,7H,2,12H2,1H3/t7-/m1/s1 |
| InChIKey | VFKNXWZZXQYCIN-SSDOTTSWSA-N |
| XLogP | 1.85 |
| TPSA | 95.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.25 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|