C11H16ClNO2 — CID 171217616
4-[(1S)-1-amino-3-methylbut-3-enyl]benzene-1,2-diol;hydrochloride (PubChem CID 171217616) has the molecular formula C11H16ClNO2 and a molecular weight of 229.71 g/mol. Its IUPAC name is 4-[(1S)-1-amino-3-methylbut-3-enyl]benzene-1,2-diol;hydrochloride.
| Compound Name | 4-[(1S)-1-amino-3-methylbut-3-enyl]benzene-1,2-diol;hydrochloride |
|---|---|
| PubChem CID | 171217616 |
| Molecular Formula | C11H16ClNO2 |
| Molecular Weight | 229.71 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 4-[(1S)-1-amino-3-methylbut-3-enyl]benzene-1,2-diol;hydrochloride |
| SMILES | C=C(C)C[C@H](N)c1ccc(O)c(O)c1.Cl |
| InChI | InChI=1S/C11H15NO2.ClH/c1-7(2)5-9(12)8-3-4-10(13)11(14)6-8;/h3-4,6,9,13-14H,1,5,12H2,2H3;1H/t9-;/m0./s1 |
| InChIKey | IFWNXWHREKMDOC-FVGYRXGTSA-N |
| XLogP | 2.49 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.71 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|