C13H20ClNO2 — CID 171220395
4-[(1S)-1-amino-3-methylbut-3-enyl]-2-ethoxyphenol;hydrochloride (PubChem CID 171220395) has the molecular formula C13H20ClNO2 and a molecular weight of 257.76 g/mol. Its IUPAC name is 4-[(1S)-1-amino-3-methylbut-3-enyl]-2-ethoxyphenol;hydrochloride.
| Compound Name | 4-[(1S)-1-amino-3-methylbut-3-enyl]-2-ethoxyphenol;hydrochloride |
|---|---|
| PubChem CID | 171220395 |
| Molecular Formula | C13H20ClNO2 |
| Molecular Weight | 257.76 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | 4-[(1S)-1-amino-3-methylbut-3-enyl]-2-ethoxyphenol;hydrochloride |
| SMILES | C=C(C)C[C@H](N)c1ccc(O)c(OCC)c1.Cl |
| InChI | InChI=1S/C13H19NO2.ClH/c1-4-16-13-8-10(5-6-12(13)15)11(14)7-9(2)3;/h5-6,8,11,15H,2,4,7,14H2,1,3H3;1H/t11-;/m0./s1 |
| InChIKey | HZJUMWUEPHEOMV-MERQFXBCSA-N |
| XLogP | 3.18 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.76 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|