C12H17ClF3NO2 — CID 171200839
4-[(1R)-1-amino-4,4,4-trifluorobutyl]-2-ethoxyphenol;hydrochloride (PubChem CID 171200839) has the molecular formula C12H17ClF3NO2 and a molecular weight of 299.72 g/mol. Its IUPAC name is 4-[(1R)-1-amino-4,4,4-trifluorobutyl]-2-ethoxyphenol;hydrochloride.
| Compound Name | 4-[(1R)-1-amino-4,4,4-trifluorobutyl]-2-ethoxyphenol;hydrochloride |
|---|---|
| PubChem CID | 171200839 |
| Molecular Formula | C12H17ClF3NO2 |
| Molecular Weight | 299.72 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | 4-[(1R)-1-amino-4,4,4-trifluorobutyl]-2-ethoxyphenol;hydrochloride |
| SMILES | CCOc1cc([C@H](N)CCC(F)(F)F)ccc1O.Cl |
| InChI | InChI=1S/C12H16F3NO2.ClH/c1-2-18-11-7-8(3-4-10(11)17)9(16)5-6-12(13,14)15;/h3-4,7,9,17H,2,5-6,16H2,1H3;1H/t9-;/m1./s1 |
| InChIKey | BDPIAAXVVNICMJ-SBSPUUFOSA-N |
| XLogP | 3.56 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.72 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |