C11H13ClF5NO2 — CID 171312194
4-[(1R)-1-amino-2,2,3,3,3-pentafluoropropyl]-2-ethoxyphenol;hydrochloride (PubChem CID 171312194) has the molecular formula C11H13ClF5NO2 and a molecular weight of 321.67 g/mol. Its IUPAC name is 4-[(1R)-1-amino-2,2,3,3,3-pentafluoropropyl]-2-ethoxyphenol;hydrochloride.
| Compound Name | 4-[(1R)-1-amino-2,2,3,3,3-pentafluoropropyl]-2-ethoxyphenol;hydrochloride |
|---|---|
| PubChem CID | 171312194 |
| Molecular Formula | C11H13ClF5NO2 |
| Molecular Weight | 321.67 g/mol |
| Exact Mass | 321.06 |
| IUPAC Name | 4-[(1R)-1-amino-2,2,3,3,3-pentafluoropropyl]-2-ethoxyphenol;hydrochloride |
| SMILES | CCOc1cc([C@@H](N)C(F)(F)C(F)(F)F)ccc1O.Cl |
| InChI | InChI=1S/C11H12F5NO2.ClH/c1-2-19-8-5-6(3-4-7(8)18)9(17)10(12,13)11(14,15)16;/h3-5,9,18H,2,17H2,1H3;1H/t9-;/m1./s1 |
| InChIKey | ALMOPCIAZOVBDA-SBSPUUFOSA-N |
| XLogP | 3.41 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.67 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|