C12H18ClNO2 — CID 171200827
4-[(1R)-1-aminobut-3-enyl]-2-ethoxyphenol;hydrochloride (PubChem CID 171200827) has the molecular formula C12H18ClNO2 and a molecular weight of 243.73 g/mol. Its IUPAC name is 4-[(1R)-1-aminobut-3-enyl]-2-ethoxyphenol;hydrochloride.
| Compound Name | 4-[(1R)-1-aminobut-3-enyl]-2-ethoxyphenol;hydrochloride |
|---|---|
| PubChem CID | 171200827 |
| Molecular Formula | C12H18ClNO2 |
| Molecular Weight | 243.73 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | 4-[(1R)-1-aminobut-3-enyl]-2-ethoxyphenol;hydrochloride |
| SMILES | C=CC[C@@H](N)c1ccc(O)c(OCC)c1.Cl |
| InChI | InChI=1S/C12H17NO2.ClH/c1-3-5-10(13)9-6-7-11(14)12(8-9)15-4-2;/h3,6-8,10,14H,1,4-5,13H2,2H3;1H/t10-;/m1./s1 |
| InChIKey | DXACZZVIGJFOND-HNCPQSOCSA-N |
| XLogP | 2.79 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.73 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|