C10H12FNO2 — CID 103456925
1-cyclopropyl-2-(3-fluoro-4-pyridinyl)ethane-1,2-diol (PubChem CID 103456925) has the molecular formula C10H12FNO2 and a molecular weight of 197.21 g/mol. Its IUPAC name is 1-cyclopropyl-2-(3-fluoro-4-pyridinyl)ethane-1,2-diol.
| Compound Name | 1-cyclopropyl-2-(3-fluoro-4-pyridinyl)ethane-1,2-diol |
|---|---|
| PubChem CID | 103456925 |
| Molecular Formula | C10H12FNO2 |
| Molecular Weight | 197.21 g/mol |
| Exact Mass | 197.09 |
| IUPAC Name | 1-cyclopropyl-2-(3-fluoro-4-pyridinyl)ethane-1,2-diol |
| SMILES | OC(c1ccncc1F)C(O)C1CC1 |
| InChI | InChI=1S/C10H12FNO2/c11-8-5-12-4-3-7(8)10(14)9(13)6-1-2-6/h3-6,9-10,13-14H,1-2H2 |
| InChIKey | QYOSKFLBDTZGNZ-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.21 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |