C12H11F4NO2 — CID 165405329
(3R)-3-(3-fluoro-4-pyridinyl)-3-[1-(trifluoromethyl)cyclopropyl]propanoic acid (PubChem CID 165405329) has the molecular formula C12H11F4NO2 and a molecular weight of 277.22 g/mol. Its IUPAC name is (3R)-3-(3-fluoro-4-pyridinyl)-3-[1-(trifluoromethyl)cyclopropyl]propanoic acid.
| Compound Name | (3R)-3-(3-fluoro-4-pyridinyl)-3-[1-(trifluoromethyl)cyclopropyl]propanoic acid |
|---|---|
| PubChem CID | 165405329 |
| Molecular Formula | C12H11F4NO2 |
| Molecular Weight | 277.22 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | (3R)-3-(3-fluoro-4-pyridinyl)-3-[1-(trifluoromethyl)cyclopropyl]propanoic acid |
| SMILES | O=C(O)C[C@H](c1ccncc1F)C1(C(F)(F)F)CC1 |
| InChI | InChI=1S/C12H11F4NO2/c13-9-6-17-4-1-7(9)8(5-10(18)19)11(2-3-11)12(14,15)16/h1,4,6,8H,2-3,5H2,(H,18,19)/t8-/m1/s1 |
| InChIKey | IJJMCZIFGVSKAI-MRVPVSSYSA-N |
| XLogP | 3.12 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.22 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |