C12H12F3NO2 — CID 165405569
(3R)-3-pyridin-2-yl-3-[1-(trifluoromethyl)cyclopropyl]propanoic acid (PubChem CID 165405569) has the molecular formula C12H12F3NO2 and a molecular weight of 259.23 g/mol. Its IUPAC name is (3R)-3-pyridin-2-yl-3-[1-(trifluoromethyl)cyclopropyl]propanoic acid.
| Compound Name | (3R)-3-pyridin-2-yl-3-[1-(trifluoromethyl)cyclopropyl]propanoic acid |
|---|---|
| PubChem CID | 165405569 |
| Molecular Formula | C12H12F3NO2 |
| Molecular Weight | 259.23 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | (3R)-3-pyridin-2-yl-3-[1-(trifluoromethyl)cyclopropyl]propanoic acid |
| SMILES | O=C(O)C[C@@H](c1ccccn1)C1(C(F)(F)F)CC1 |
| InChI | InChI=1S/C12H12F3NO2/c13-12(14,15)11(4-5-11)8(7-10(17)18)9-3-1-2-6-16-9/h1-3,6,8H,4-5,7H2,(H,17,18)/t8-/m0/s1 |
| InChIKey | IBNYDMCXYOQSEO-QMMMGPOBSA-N |
| XLogP | 2.98 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.23 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |