C16H19BrOS — CID 106828373
(7-bromo-1-benzothiophen-3-yl)-(1-methylcyclohexyl)methanol (PubChem CID 106828373) has the molecular formula C16H19BrOS and a molecular weight of 339.30 g/mol. Its IUPAC name is (7-bromo-1-benzothiophen-3-yl)-(1-methylcyclohexyl)methanol.
| Compound Name | (7-bromo-1-benzothiophen-3-yl)-(1-methylcyclohexyl)methanol |
|---|---|
| PubChem CID | 106828373 |
| Molecular Formula | C16H19BrOS |
| Molecular Weight | 339.30 g/mol |
| Exact Mass | 338.03 |
| IUPAC Name | (7-bromo-1-benzothiophen-3-yl)-(1-methylcyclohexyl)methanol |
| SMILES | CC1(C(O)c2csc3c(Br)cccc23)CCCCC1 |
| InChI | InChI=1S/C16H19BrOS/c1-16(8-3-2-4-9-16)15(18)12-10-19-14-11(12)6-5-7-13(14)17/h5-7,10,15,18H,2-4,8-9H2,1H3 |
| InChIKey | ZHINNSQMHXFUJN-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.30 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |