C16H18Br2S — CID 81147613
7-bromo-3-(1-bromo-2-cyclohexylethyl)-1-benzothiophene (PubChem CID 81147613) has the molecular formula C16H18Br2S and a molecular weight of 402.20 g/mol. Its IUPAC name is 7-bromo-3-(1-bromo-2-cyclohexylethyl)-1-benzothiophene.
| Compound Name | 7-bromo-3-(1-bromo-2-cyclohexylethyl)-1-benzothiophene |
|---|---|
| PubChem CID | 81147613 |
| Molecular Formula | C16H18Br2S |
| Molecular Weight | 402.20 g/mol |
| Exact Mass | 399.95 |
| IUPAC Name | 7-bromo-3-(1-bromo-2-cyclohexylethyl)-1-benzothiophene |
| SMILES | Brc1cccc2c(C(Br)CC3CCCCC3)csc12 |
| InChI | InChI=1S/C16H18Br2S/c17-14-8-4-7-12-13(10-19-16(12)14)15(18)9-11-5-2-1-3-6-11/h4,7-8,10-11,15H,1-3,5-6,9H2 |
| InChIKey | IFLLCNILZQQQEG-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.20 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|