C16H20BrNS — CID 81141835
1-(7-bromo-1-benzothiophen-3-yl)-2-cyclohexylethanamine (PubChem CID 81141835) has the molecular formula C16H20BrNS and a molecular weight of 338.31 g/mol. Its IUPAC name is 1-(7-bromo-1-benzothiophen-3-yl)-2-cyclohexylethanamine.
| Compound Name | 1-(7-bromo-1-benzothiophen-3-yl)-2-cyclohexylethanamine |
|---|---|
| PubChem CID | 81141835 |
| Molecular Formula | C16H20BrNS |
| Molecular Weight | 338.31 g/mol |
| Exact Mass | 337.05 |
| IUPAC Name | 1-(7-bromo-1-benzothiophen-3-yl)-2-cyclohexylethanamine |
| SMILES | NC(CC1CCCCC1)c1csc2c(Br)cccc12 |
| InChI | InChI=1S/C16H20BrNS/c17-14-8-4-7-12-13(10-19-16(12)14)15(18)9-11-5-2-1-3-6-11/h4,7-8,10-11,15H,1-3,5-6,9,18H2 |
| InChIKey | MFQZIAOOHJUTAI-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.31 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |