C15H19BrN2OS — CID 81141780
5-amino-5-(7-bromo-1-benzothiophen-3-yl)-3,3-dimethylpentanamide (PubChem CID 81141780) has the molecular formula C15H19BrN2OS and a molecular weight of 355.30 g/mol. Its IUPAC name is 5-amino-5-(7-bromo-1-benzothiophen-3-yl)-3,3-dimethylpentanamide.
| Compound Name | 5-amino-5-(7-bromo-1-benzothiophen-3-yl)-3,3-dimethylpentanamide |
|---|---|
| PubChem CID | 81141780 |
| Molecular Formula | C15H19BrN2OS |
| Molecular Weight | 355.30 g/mol |
| Exact Mass | 354.04 |
| IUPAC Name | 5-amino-5-(7-bromo-1-benzothiophen-3-yl)-3,3-dimethylpentanamide |
| SMILES | CC(C)(CC(N)=O)CC(N)c1csc2c(Br)cccc12 |
| InChI | InChI=1S/C15H19BrN2OS/c1-15(2,7-13(18)19)6-12(17)10-8-20-14-9(10)4-3-5-11(14)16/h3-5,8,12H,6-7,17H2,1-2H3,(H2,18,19) |
| InChIKey | IWMSXJLPDBFBMQ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.30 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |