C14H17BrOS — CID 81153135
1-(7-bromo-1-benzothiophen-3-yl)-2,2-dimethylbutan-1-ol (PubChem CID 81153135) has the molecular formula C14H17BrOS and a molecular weight of 313.26 g/mol. Its IUPAC name is 1-(7-bromo-1-benzothiophen-3-yl)-2,2-dimethylbutan-1-ol.
| Compound Name | 1-(7-bromo-1-benzothiophen-3-yl)-2,2-dimethylbutan-1-ol |
|---|---|
| PubChem CID | 81153135 |
| Molecular Formula | C14H17BrOS |
| Molecular Weight | 313.26 g/mol |
| Exact Mass | 312.02 |
| IUPAC Name | 1-(7-bromo-1-benzothiophen-3-yl)-2,2-dimethylbutan-1-ol |
| SMILES | CCC(C)(C)C(O)c1csc2c(Br)cccc12 |
| InChI | InChI=1S/C14H17BrOS/c1-4-14(2,3)13(16)10-8-17-12-9(10)6-5-7-11(12)15/h5-8,13,16H,4H2,1-3H3 |
| InChIKey | QBIGUNKYSIORGX-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.26 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |