C10H5BrClF3S — CID 81146675
7-bromo-3-(1-chloro-2,2,2-trifluoroethyl)-1-benzothiophene (PubChem CID 81146675) has the molecular formula C10H5BrClF3S and a molecular weight of 329.57 g/mol. Its IUPAC name is 7-bromo-3-(1-chloro-2,2,2-trifluoroethyl)-1-benzothiophene.
| Compound Name | 7-bromo-3-(1-chloro-2,2,2-trifluoroethyl)-1-benzothiophene |
|---|---|
| PubChem CID | 81146675 |
| Molecular Formula | C10H5BrClF3S |
| Molecular Weight | 329.57 g/mol |
| Exact Mass | 327.89 |
| IUPAC Name | 7-bromo-3-(1-chloro-2,2,2-trifluoroethyl)-1-benzothiophene |
| SMILES | FC(F)(F)C(Cl)c1csc2c(Br)cccc12 |
| InChI | InChI=1S/C10H5BrClF3S/c11-7-3-1-2-5-6(4-16-8(5)7)9(12)10(13,14)15/h1-4,9H |
| InChIKey | VQUFQRCZSAQGEW-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.57 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|