C17H28FN3 — CID 105243772
1-[(4-fluoro-3-methylphenyl)-hydrazinylmethyl]-N,N-dimethylcycloheptan-1-amine (PubChem CID 105243772) has the molecular formula C17H28FN3 and a molecular weight of 293.43 g/mol. Its IUPAC name is 1-[(4-fluoro-3-methylphenyl)-hydrazinylmethyl]-N,N-dimethylcycloheptan-1-amine.
| Compound Name | 1-[(4-fluoro-3-methylphenyl)-hydrazinylmethyl]-N,N-dimethylcycloheptan-1-amine |
|---|---|
| PubChem CID | 105243772 |
| Molecular Formula | C17H28FN3 |
| Molecular Weight | 293.43 g/mol |
| Exact Mass | 293.23 |
| IUPAC Name | 1-[(4-fluoro-3-methylphenyl)-hydrazinylmethyl]-N,N-dimethylcycloheptan-1-amine |
| SMILES | Cc1cc(C(NN)C2(N(C)C)CCCCCC2)ccc1F |
| InChI | InChI=1S/C17H28FN3/c1-13-12-14(8-9-15(13)18)16(20-19)17(21(2)3)10-6-4-5-7-11-17/h8-9,12,16,20H,4-7,10-11,19H2,1-3H3 |
| InChIKey | LLSRRTQTRKGDFA-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.43 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|