C10H13ClFNO2 — CID 83925234
2-amino-1-(2-chloro-6-fluorophenyl)butane-1,4-diol (PubChem CID 83925234) has the molecular formula C10H13ClFNO2 and a molecular weight of 233.67 g/mol. Its IUPAC name is 2-amino-1-(2-chloro-6-fluorophenyl)butane-1,4-diol.
| Compound Name | 2-amino-1-(2-chloro-6-fluorophenyl)butane-1,4-diol |
|---|---|
| PubChem CID | 83925234 |
| Molecular Formula | C10H13ClFNO2 |
| Molecular Weight | 233.67 g/mol |
| Exact Mass | 233.06 |
| IUPAC Name | 2-amino-1-(2-chloro-6-fluorophenyl)butane-1,4-diol |
| SMILES | NC(CCO)C(O)c1c(F)cccc1Cl |
| InChI | InChI=1S/C10H13ClFNO2/c11-6-2-1-3-7(12)9(6)10(15)8(13)4-5-14/h1-3,8,10,14-15H,4-5,13H2 |
| InChIKey | JBYXRLPQHMDQPV-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.67 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |