C9H10Cl2O2 — CID 90422655
(1S)-1-(2,6-dichlorophenyl)propane-1,3-diol (PubChem CID 90422655) has the molecular formula C9H10Cl2O2 and a molecular weight of 221.08 g/mol. Its IUPAC name is (1S)-1-(2,6-dichlorophenyl)propane-1,3-diol.
| Compound Name | (1S)-1-(2,6-dichlorophenyl)propane-1,3-diol |
|---|---|
| PubChem CID | 90422655 |
| Molecular Formula | C9H10Cl2O2 |
| Molecular Weight | 221.08 g/mol |
| Exact Mass | 220.01 |
| IUPAC Name | (1S)-1-(2,6-dichlorophenyl)propane-1,3-diol |
| SMILES | OCC[C@H](O)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C9H10Cl2O2/c10-6-2-1-3-7(11)9(6)8(13)4-5-12/h1-3,8,12-13H,4-5H2/t8-/m0/s1 |
| InChIKey | IQZSMBLXVQXOTO-QMMMGPOBSA-N |
| XLogP | 2.41 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.08 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |