C9H11F2NO — CID 131195771
2-[(1S)-1-aminopropyl]-3,6-difluorophenol (PubChem CID 131195771) has the molecular formula C9H11F2NO and a molecular weight of 187.19 g/mol. Its IUPAC name is 2-[(1S)-1-aminopropyl]-3,6-difluorophenol.
| Compound Name | 2-[(1S)-1-aminopropyl]-3,6-difluorophenol |
|---|---|
| PubChem CID | 131195771 |
| Molecular Formula | C9H11F2NO |
| Molecular Weight | 187.19 g/mol |
| Exact Mass | 187.08 |
| IUPAC Name | 2-[(1S)-1-aminopropyl]-3,6-difluorophenol |
| SMILES | CC[C@H](N)c1c(F)ccc(F)c1O |
| InChI | InChI=1S/C9H11F2NO/c1-2-7(12)8-5(10)3-4-6(11)9(8)13/h3-4,7,13H,2,12H2,1H3/t7-/m0/s1 |
| InChIKey | XZDYZGJVFPCLAR-ZETCQYMHSA-N |
| XLogP | 2.08 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.19 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|