C11H11BrF3NO4 — CID 171900337
4-[4-bromo-2-(trifluoromethoxy)phenyl]-3,4-dihydroxybutanamide (PubChem CID 171900337) has the molecular formula C11H11BrF3NO4 and a molecular weight of 358.11 g/mol. Its IUPAC name is 4-[4-bromo-2-(trifluoromethoxy)phenyl]-3,4-dihydroxybutanamide.
| Compound Name | 4-[4-bromo-2-(trifluoromethoxy)phenyl]-3,4-dihydroxybutanamide |
|---|---|
| PubChem CID | 171900337 |
| Molecular Formula | C11H11BrF3NO4 |
| Molecular Weight | 358.11 g/mol |
| Exact Mass | 356.98 |
| IUPAC Name | 4-[4-bromo-2-(trifluoromethoxy)phenyl]-3,4-dihydroxybutanamide |
| SMILES | NC(=O)CC(O)C(O)c1ccc(Br)cc1OC(F)(F)F |
| InChI | InChI=1S/C11H11BrF3NO4/c12-5-1-2-6(8(3-5)20-11(13,14)15)10(19)7(17)4-9(16)18/h1-3,7,10,17,19H,4H2,(H2,16,18) |
| InChIKey | DBTNRPLGWFGFBY-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.11 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |