C13H15BrF3NO4 — CID 171884212
N-[4-[4-bromo-2-(trifluoromethoxy)phenyl]-3,4-dihydroxybutyl]acetamide (PubChem CID 171884212) has the molecular formula C13H15BrF3NO4 and a molecular weight of 386.16 g/mol. Its IUPAC name is N-[4-[4-bromo-2-(trifluoromethoxy)phenyl]-3,4-dihydroxybutyl]acetamide.
| Compound Name | N-[4-[4-bromo-2-(trifluoromethoxy)phenyl]-3,4-dihydroxybutyl]acetamide |
|---|---|
| PubChem CID | 171884212 |
| Molecular Formula | C13H15BrF3NO4 |
| Molecular Weight | 386.16 g/mol |
| Exact Mass | 385.01 |
| IUPAC Name | N-[4-[4-bromo-2-(trifluoromethoxy)phenyl]-3,4-dihydroxybutyl]acetamide |
| SMILES | CC(=O)NCCC(O)C(O)c1ccc(Br)cc1OC(F)(F)F |
| InChI | InChI=1S/C13H15BrF3NO4/c1-7(19)18-5-4-10(20)12(21)9-3-2-8(14)6-11(9)22-13(15,16)17/h2-3,6,10,12,20-21H,4-5H2,1H3,(H,18,19) |
| InChIKey | ZNSFWPOPHRCRLT-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.16 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |