C14H15F3N2O3 — CID 171883958
N-[4-[2-cyano-4-(trifluoromethyl)phenyl]-3,4-dihydroxybutyl]acetamide (PubChem CID 171883958) has the molecular formula C14H15F3N2O3 and a molecular weight of 316.28 g/mol. Its IUPAC name is N-[4-[2-cyano-4-(trifluoromethyl)phenyl]-3,4-dihydroxybutyl]acetamide.
| Compound Name | N-[4-[2-cyano-4-(trifluoromethyl)phenyl]-3,4-dihydroxybutyl]acetamide |
|---|---|
| PubChem CID | 171883958 |
| Molecular Formula | C14H15F3N2O3 |
| Molecular Weight | 316.28 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | N-[4-[2-cyano-4-(trifluoromethyl)phenyl]-3,4-dihydroxybutyl]acetamide |
| SMILES | CC(=O)NCCC(O)C(O)c1ccc(C(F)(F)F)cc1C#N |
| InChI | InChI=1S/C14H15F3N2O3/c1-8(20)19-5-4-12(21)13(22)11-3-2-10(14(15,16)17)6-9(11)7-18/h2-3,6,12-13,21-22H,4-5H2,1H3,(H,19,20) |
| InChIKey | KEDODTKLDOHRON-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 93.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.28 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |