C15H21BrClNO4 — CID 171885919
tert-butyl N-[4-(2-bromo-5-chlorophenyl)-3,4-dihydroxybutyl]carbamate (PubChem CID 171885919) has the molecular formula C15H21BrClNO4 and a molecular weight of 394.69 g/mol. Its IUPAC name is tert-butyl N-[4-(2-bromo-5-chlorophenyl)-3,4-dihydroxybutyl]carbamate.
| Compound Name | tert-butyl N-[4-(2-bromo-5-chlorophenyl)-3,4-dihydroxybutyl]carbamate |
|---|---|
| PubChem CID | 171885919 |
| Molecular Formula | C15H21BrClNO4 |
| Molecular Weight | 394.69 g/mol |
| Exact Mass | 393.03 |
| IUPAC Name | tert-butyl N-[4-(2-bromo-5-chlorophenyl)-3,4-dihydroxybutyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCC(O)C(O)c1cc(Cl)ccc1Br |
| InChI | InChI=1S/C15H21BrClNO4/c1-15(2,3)22-14(21)18-7-6-12(19)13(20)10-8-9(17)4-5-11(10)16/h4-5,8,12-13,19-20H,6-7H2,1-3H3,(H,18,21) |
| InChIKey | IEJFXRHSEHQWGM-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.69 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |