C15H22N2O7 — CID 170832834
tert-butyl N-[2,3-dihydroxy-3-(2-methoxy-5-nitrophenyl)propyl]carbamate (PubChem CID 170832834) has the molecular formula C15H22N2O7 and a molecular weight of 342.35 g/mol. Its IUPAC name is tert-butyl N-[2,3-dihydroxy-3-(2-methoxy-5-nitrophenyl)propyl]carbamate.
| Compound Name | tert-butyl N-[2,3-dihydroxy-3-(2-methoxy-5-nitrophenyl)propyl]carbamate |
|---|---|
| PubChem CID | 170832834 |
| Molecular Formula | C15H22N2O7 |
| Molecular Weight | 342.35 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | tert-butyl N-[2,3-dihydroxy-3-(2-methoxy-5-nitrophenyl)propyl]carbamate |
| SMILES | COc1ccc([N+](=O)[O-])cc1C(O)C(O)CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H22N2O7/c1-15(2,3)24-14(20)16-8-11(18)13(19)10-7-9(17(21)22)5-6-12(10)23-4/h5-7,11,13,18-19H,8H2,1-4H3,(H,16,20) |
| InChIKey | PUKNBCDXQRVEPM-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 131.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.35 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|